C14H16O5S — CID 90272213
3-hydroxy-4-naphthalen-2-yloxybutane-1-sulfonic acid (PubChem CID 90272213) has the molecular formula C14H16O5S and a molecular weight of 296.34 g/mol. Its IUPAC name is 3-hydroxy-4-naphthalen-2-yloxybutane-1-sulfonic acid.
| Compound Name | 3-hydroxy-4-naphthalen-2-yloxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 90272213 |
| Molecular Formula | C14H16O5S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-hydroxy-4-naphthalen-2-yloxybutane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCC(O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H16O5S/c15-13(7-8-20(16,17)18)10-19-14-6-5-11-3-1-2-4-12(11)9-14/h1-6,9,13,15H,7-8,10H2,(H,16,17,18) |
| InChIKey | ORNFEVIOLNXBHP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|