C15H18NO5S- — CID 3104968
N-ethyl-N-(2-hydroxy-3-naphthalen-2-yloxypropyl)sulfamate (PubChem CID 3104968) has the molecular formula C15H18NO5S- and a molecular weight of 324.38 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxy-3-naphthalen-2-yloxypropyl)sulfamate.
| Compound Name | N-ethyl-N-(2-hydroxy-3-naphthalen-2-yloxypropyl)sulfamate |
|---|---|
| PubChem CID | 3104968 |
| Molecular Formula | C15H18NO5S- |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-ethyl-N-(2-hydroxy-3-naphthalen-2-yloxypropyl)sulfamate |
| SMILES | CCN(CC(O)COc1ccc2ccccc2c1)S(=O)(=O)[O-] |
| InChI | InChI=1S/C15H19NO5S/c1-2-16(22(18,19)20)10-14(17)11-21-15-8-7-12-5-3-4-6-13(12)9-15/h3-9,14,17H,2,10-11H2,1H3,(H,18,19,20)/p-1 |
| InChIKey | AKJXGNWOIJDDKL-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|