C19H28ClNO2 — CID 2834359
1-(dipropylamino)-3-naphthalen-2-yloxypropan-2-ol;hydrochloride (PubChem CID 2834359) has the molecular formula C19H28ClNO2 and a molecular weight of 337.89 g/mol. Its IUPAC name is 1-(dipropylamino)-3-naphthalen-2-yloxypropan-2-ol;hydrochloride.
| Compound Name | 1-(dipropylamino)-3-naphthalen-2-yloxypropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 2834359 |
| Molecular Formula | C19H28ClNO2 |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-(dipropylamino)-3-naphthalen-2-yloxypropan-2-ol;hydrochloride |
| SMILES | CCCN(CCC)CC(O)COc1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C19H27NO2.ClH/c1-3-11-20(12-4-2)14-18(21)15-22-19-10-9-16-7-5-6-8-17(16)13-19;/h5-10,13,18,21H,3-4,11-12,14-15H2,1-2H3;1H |
| InChIKey | FIZIFGZQIVLZNR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |