C12H19ClNO2+ — CID 4751881
[3-(4-chlorophenoxy)-2-hydroxypropyl]-propan-2-ylazanium (PubChem CID 4751881) has the molecular formula C12H19ClNO2+ and a molecular weight of 244.74 g/mol. Its IUPAC name is [3-(4-chlorophenoxy)-2-hydroxypropyl]-propan-2-ylazanium.
| Compound Name | [3-(4-chlorophenoxy)-2-hydroxypropyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 4751881 |
| Molecular Formula | C12H19ClNO2+ |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | [3-(4-chlorophenoxy)-2-hydroxypropyl]-propan-2-ylazanium |
| SMILES | CC(C)[NH2+]CC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H18ClNO2/c1-9(2)14-7-11(15)8-16-12-5-3-10(13)4-6-12/h3-6,9,11,14-15H,7-8H2,1-2H3/p+1 |
| InChIKey | JHNLCWKHEYGEHY-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |