C9H12ClNO2 — CID 2049238
(2S)-1-amino-3-(4-chlorophenoxy)propan-2-ol (PubChem CID 2049238) has the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. Its IUPAC name is (2S)-1-amino-3-(4-chlorophenoxy)propan-2-ol.
| Compound Name | (2S)-1-amino-3-(4-chlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 2049238 |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | (2S)-1-amino-3-(4-chlorophenoxy)propan-2-ol |
| SMILES | NC[C@H](O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H12ClNO2/c10-7-1-3-9(4-2-7)13-6-8(12)5-11/h1-4,8,12H,5-6,11H2/t8-/m0/s1 |
| InChIKey | WCTVXSRNGUMJKC-QMMMGPOBSA-N |
| XLogP | 1.04 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.65 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |