C10H13ClN2O3 — CID 14685227
[3-(4-chlorophenoxy)-2-hydroxypropyl]urea (PubChem CID 14685227) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is [3-(4-chlorophenoxy)-2-hydroxypropyl]urea.
| Compound Name | [3-(4-chlorophenoxy)-2-hydroxypropyl]urea |
|---|---|
| PubChem CID | 14685227 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | [3-(4-chlorophenoxy)-2-hydroxypropyl]urea |
| SMILES | NC(=O)NCC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H13ClN2O3/c11-7-1-3-9(4-2-7)16-6-8(14)5-13-10(12)15/h1-4,8,14H,5-6H2,(H3,12,13,15) |
| InChIKey | HETOURUQJKIMQQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |