C17H19ClN2O4 — CID 99928759
N-[(2R)-3-(4-chlorophenoxy)-2-hydroxypropyl]-1-ethyl-2-oxopyridine-4-carboxamide (PubChem CID 99928759) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is N-[(2R)-3-(4-chlorophenoxy)-2-hydroxypropyl]-1-ethyl-2-oxopyridine-4-carboxamide.
| Compound Name | N-[(2R)-3-(4-chlorophenoxy)-2-hydroxypropyl]-1-ethyl-2-oxopyridine-4-carboxamide |
|---|---|
| PubChem CID | 99928759 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[(2R)-3-(4-chlorophenoxy)-2-hydroxypropyl]-1-ethyl-2-oxopyridine-4-carboxamide |
| SMILES | CCn1ccc(C(=O)NC[C@@H](O)COc2ccc(Cl)cc2)cc1=O |
| InChI | InChI=1S/C17H19ClN2O4/c1-2-20-8-7-12(9-16(20)22)17(23)19-10-14(21)11-24-15-5-3-13(18)4-6-15/h3-9,14,21H,2,10-11H2,1H3,(H,19,23)/t14-/m1/s1 |
| InChIKey | IIVIGSOFEPIEKE-CQSZACIVSA-N |
| XLogP | 1.69 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |