C16H28NO2+ — CID 6940656
[(2S)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-propan-2-ylazanium (PubChem CID 6940656) has the molecular formula C16H28NO2+ and a molecular weight of 266.40 g/mol. Its IUPAC name is [(2S)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-propan-2-ylazanium.
| Compound Name | [(2S)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 6940656 |
| Molecular Formula | C16H28NO2+ |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | [(2S)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-propan-2-ylazanium |
| SMILES | CC(C)[NH2+]C[C@H](O)COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H27NO2/c1-12(2)17-10-14(18)11-19-15-8-6-13(7-9-15)16(3,4)5/h6-9,12,14,17-18H,10-11H2,1-5H3/p+1/t14-/m0/s1 |
| InChIKey | BJRJHSIVXVLLHI-AWEZNQCLSA-O |
| XLogP | 1.70 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |