C17H29NO2 — CID 2843556
1-(4-tert-butylphenoxy)-3-(diethylamino)propan-2-ol (PubChem CID 2843556) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 1-(4-tert-butylphenoxy)-3-(diethylamino)propan-2-ol.
| Compound Name | 1-(4-tert-butylphenoxy)-3-(diethylamino)propan-2-ol |
|---|---|
| PubChem CID | 2843556 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 1-(4-tert-butylphenoxy)-3-(diethylamino)propan-2-ol |
| SMILES | CCN(CC)CC(O)COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H29NO2/c1-6-18(7-2)12-15(19)13-20-16-10-8-14(9-11-16)17(3,4)5/h8-11,15,19H,6-7,12-13H2,1-5H3 |
| InChIKey | XEBOHDDYDKJLHV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |