C9H22N2O3 — CID 62141108
1-(2-aminoethylamino)-3-(2-ethoxyethoxy)propan-2-ol (PubChem CID 62141108) has the molecular formula C9H22N2O3 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(2-aminoethylamino)-3-(2-ethoxyethoxy)propan-2-ol.
| Compound Name | 1-(2-aminoethylamino)-3-(2-ethoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 62141108 |
| Molecular Formula | C9H22N2O3 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | 1-(2-aminoethylamino)-3-(2-ethoxyethoxy)propan-2-ol |
| SMILES | CCOCCOCC(O)CNCCN |
| InChI | InChI=1S/C9H22N2O3/c1-2-13-5-6-14-8-9(12)7-11-4-3-10/h9,11-12H,2-8,10H2,1H3 |
| InChIKey | NHDBCENHQQIJHW-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|