C10H22N2O4 — CID 60910580
3-[[3-(2-ethoxyethoxy)-2-hydroxypropyl]amino]propanamide (PubChem CID 60910580) has the molecular formula C10H22N2O4 and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-[[3-(2-ethoxyethoxy)-2-hydroxypropyl]amino]propanamide.
| Compound Name | 3-[[3-(2-ethoxyethoxy)-2-hydroxypropyl]amino]propanamide |
|---|---|
| PubChem CID | 60910580 |
| Molecular Formula | C10H22N2O4 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 3-[[3-(2-ethoxyethoxy)-2-hydroxypropyl]amino]propanamide |
| SMILES | CCOCCOCC(O)CNCCC(N)=O |
| InChI | InChI=1S/C10H22N2O4/c1-2-15-5-6-16-8-9(13)7-12-4-3-10(11)14/h9,12-13H,2-8H2,1H3,(H2,11,14) |
| InChIKey | JKIHJHGNYNZYPH-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|