C10H22N2O5 — CID 106174317
3-[[3-(2-ethoxyethoxy)-2-hydroxypropyl]amino]-2-hydroxypropanamide (PubChem CID 106174317) has the molecular formula C10H22N2O5 and a molecular weight of 250.29 g/mol. Its IUPAC name is 3-[[3-(2-ethoxyethoxy)-2-hydroxypropyl]amino]-2-hydroxypropanamide.
| Compound Name | 3-[[3-(2-ethoxyethoxy)-2-hydroxypropyl]amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106174317 |
| Molecular Formula | C10H22N2O5 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-[[3-(2-ethoxyethoxy)-2-hydroxypropyl]amino]-2-hydroxypropanamide |
| SMILES | CCOCCOCC(O)CNCC(O)C(N)=O |
| InChI | InChI=1S/C10H22N2O5/c1-2-16-3-4-17-7-8(13)5-12-6-9(14)10(11)15/h8-9,12-14H,2-7H2,1H3,(H2,11,15) |
| InChIKey | AXDDUORKCIZMTR-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|