C12H27NO5 — CID 114099796
1-(2,3-dimethoxypropylamino)-3-(2-ethoxyethoxy)propan-2-ol (PubChem CID 114099796) has the molecular formula C12H27NO5 and a molecular weight of 265.35 g/mol. Its IUPAC name is 1-(2,3-dimethoxypropylamino)-3-(2-ethoxyethoxy)propan-2-ol.
| Compound Name | 1-(2,3-dimethoxypropylamino)-3-(2-ethoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 114099796 |
| Molecular Formula | C12H27NO5 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 1-(2,3-dimethoxypropylamino)-3-(2-ethoxyethoxy)propan-2-ol |
| SMILES | CCOCCOCC(O)CNCC(COC)OC |
| InChI | InChI=1S/C12H27NO5/c1-4-17-5-6-18-9-11(14)7-13-8-12(16-3)10-15-2/h11-14H,4-10H2,1-3H3 |
| InChIKey | UVHUAXVFOUGJCP-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|