C51H50N2O5 — CID 91107546
(2S)-1-(3-amino-4-phenylmethoxyphenoxy)-3-[[3-phenyl-1,1-bis(4-phenylmethoxyphenyl)propan-2-yl]amino]propan-2-ol (PubChem CID 91107546) has the molecular formula C51H50N2O5 and a molecular weight of 770.97 g/mol. Its IUPAC name is (2S)-1-(3-amino-4-phenylmethoxyphenoxy)-3-[[3-phenyl-1,1-bis(4-phenylmethoxyphenyl)propan-2-yl]amino]propan-2-ol.
| Compound Name | (2S)-1-(3-amino-4-phenylmethoxyphenoxy)-3-[[3-phenyl-1,1-bis(4-phenylmethoxyphenyl)propan-2-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 91107546 |
| Molecular Formula | C51H50N2O5 |
| Molecular Weight | 770.97 g/mol |
| Exact Mass | 770.37 |
| IUPAC Name | (2S)-1-(3-amino-4-phenylmethoxyphenoxy)-3-[[3-phenyl-1,1-bis(4-phenylmethoxyphenyl)propan-2-yl]amino]propan-2-ol |
| SMILES | Nc1cc(OC[C@@H](O)CNC(Cc2ccccc2)C(c2ccc(OCc3ccccc3)cc2)c2ccc(OCc3ccccc3)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C51H50N2O5/c52-48-32-47(29-30-50(48)58-36-41-19-11-4-12-20-41)57-37-44(54)33-53-49(31-38-13-5-1-6-14-38)51(42-21-25-45(26-22-42)55-34-39-15-7-2-8-16-39)43-23-27-46(28-24-43)56-35-40-17-9-3-10-18-40/h1-30,32,44,49,51,53-54H,31,33-37,52H2/t44-,49?/m0/s1 |
| InChIKey | PBCOTMRMPQTDHR-QXRKIAQLSA-N |
| XLogP | 9.78 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.97 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|