C26H40N2O5 — CID 175022615
1-[4-[[2-hydroxy-3-(propan-2-ylamino)propoxy]-phenylmethoxymethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 175022615) has the molecular formula C26H40N2O5 and a molecular weight of 460.62 g/mol. Its IUPAC name is 1-[4-[[2-hydroxy-3-(propan-2-ylamino)propoxy]-phenylmethoxymethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-[4-[[2-hydroxy-3-(propan-2-ylamino)propoxy]-phenylmethoxymethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 175022615 |
| Molecular Formula | C26H40N2O5 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | 1-[4-[[2-hydroxy-3-(propan-2-ylamino)propoxy]-phenylmethoxymethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)COc1ccc(C(OCc2ccccc2)OCC(O)CNC(C)C)cc1 |
| InChI | InChI=1S/C26H40N2O5/c1-19(2)27-14-23(29)17-31-25-12-10-22(11-13-25)26(32-16-21-8-6-5-7-9-21)33-18-24(30)15-28-20(3)4/h5-13,19-20,23-24,26-30H,14-18H2,1-4H3 |
| InChIKey | RRMHTTKSPZZIJZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 92.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|