C30H31NO4 — CID 91502004
4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-1-(4-hydroxyphenyl)-3-phenylpropyl]phenol (PubChem CID 91502004) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is 4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-1-(4-hydroxyphenyl)-3-phenylpropyl]phenol.
| Compound Name | 4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-1-(4-hydroxyphenyl)-3-phenylpropyl]phenol |
|---|---|
| PubChem CID | 91502004 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-1-(4-hydroxyphenyl)-3-phenylpropyl]phenol |
| SMILES | Oc1ccc(C(c2ccc(O)cc2)C(Cc2ccccc2)NC[C@H](O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C30H31NO4/c32-25-15-11-23(12-16-25)30(24-13-17-26(33)18-14-24)29(19-22-7-3-1-4-8-22)31-20-27(34)21-35-28-9-5-2-6-10-28/h1-18,27,29-34H,19-21H2/t27-,29?/m0/s1 |
| InChIKey | UCIDKCNLWAOLOS-BVOOQYFDSA-N |
| XLogP | 4.87 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |