C18H21NO5 — CID 40548644
(2R)-2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 40548644) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 40548644 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (2R)-2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccc(O)cc1)NC[C@H](O)COc1ccccc1 |
| InChI | InChI=1S/C18H21NO5/c20-14-8-6-13(7-9-14)10-17(18(22)23)19-11-15(21)12-24-16-4-2-1-3-5-16/h1-9,15,17,19-21H,10-12H2,(H,22,23)/t15-,17+/m0/s1 |
| InChIKey | CDWIBRCQGDHHBB-DOTOQJQBSA-N |
| XLogP | 1.42 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |