C14H19NO6 — CID 40548603
(2S)-2-[[(2R)-2-hydroxy-3-phenoxypropyl]amino]pentanedioic acid (PubChem CID 40548603) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-hydroxy-3-phenoxypropyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2R)-2-hydroxy-3-phenoxypropyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 40548603 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (2S)-2-[[(2R)-2-hydroxy-3-phenoxypropyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC[C@@H](O)COc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H19NO6/c16-10(9-21-11-4-2-1-3-5-11)8-15-12(14(19)20)6-7-13(17)18/h1-5,10,12,15-16H,6-9H2,(H,17,18)(H,19,20)/t10-,12+/m1/s1 |
| InChIKey | HDJZTXKMGAZXGD-PWSUYJOCSA-N |
| XLogP | 0.33 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |