C8H17NO10Si — CID 175525005
2-[(2-hydroxy-3-trihydroxysilylperoxypropyl)amino]pentanedioic acid (PubChem CID 175525005) has the molecular formula C8H17NO10Si and a molecular weight of 315.31 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-trihydroxysilylperoxypropyl)amino]pentanedioic acid.
| Compound Name | 2-[(2-hydroxy-3-trihydroxysilylperoxypropyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 175525005 |
| Molecular Formula | C8H17NO10Si |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-[(2-hydroxy-3-trihydroxysilylperoxypropyl)amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NCC(O)COO[Si](O)(O)O)C(=O)O |
| InChI | InChI=1S/C8H17NO10Si/c10-5(4-18-19-20(15,16)17)3-9-6(8(13)14)1-2-7(11)12/h5-6,9-10,15-17H,1-4H2,(H,11,12)(H,13,14) |
| InChIKey | DARJEECOZSDKDO-UHFFFAOYSA-N |
| XLogP | -3.38 |
| TPSA | 186.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|