C10H19NO6 — CID 175753969
(2S)-2-[2-(2-methoxyethoxy)ethylamino]pentanedioic acid (PubChem CID 175753969) has the molecular formula C10H19NO6 and a molecular weight of 249.26 g/mol. Its IUPAC name is (2S)-2-[2-(2-methoxyethoxy)ethylamino]pentanedioic acid.
| Compound Name | (2S)-2-[2-(2-methoxyethoxy)ethylamino]pentanedioic acid |
|---|---|
| PubChem CID | 175753969 |
| Molecular Formula | C10H19NO6 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (2S)-2-[2-(2-methoxyethoxy)ethylamino]pentanedioic acid |
| SMILES | COCCOCCN[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H19NO6/c1-16-6-7-17-5-4-11-8(10(14)15)2-3-9(12)13/h8,11H,2-7H2,1H3,(H,12,13)(H,14,15)/t8-/m0/s1 |
| InChIKey | PZFAZYCNHCALGW-QMMMGPOBSA-N |
| XLogP | -0.44 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|