C14H25ClN2O10 — CID 154696995
2-[2-[2-[2-(1,2-dicarboxyethylamino)ethoxy]ethoxy]ethylamino]butanedioic acid;hydrochloride (PubChem CID 154696995) has the molecular formula C14H25ClN2O10 and a molecular weight of 416.81 g/mol. Its IUPAC name is 2-[2-[2-[2-(1,2-dicarboxyethylamino)ethoxy]ethoxy]ethylamino]butanedioic acid;hydrochloride.
| Compound Name | 2-[2-[2-[2-(1,2-dicarboxyethylamino)ethoxy]ethoxy]ethylamino]butanedioic acid;hydrochloride |
|---|---|
| PubChem CID | 154696995 |
| Molecular Formula | C14H25ClN2O10 |
| Molecular Weight | 416.81 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-[2-[2-[2-(1,2-dicarboxyethylamino)ethoxy]ethoxy]ethylamino]butanedioic acid;hydrochloride |
| SMILES | Cl.O=C(O)CC(NCCOCCOCCNC(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H24N2O10.ClH/c17-11(18)7-9(13(21)22)15-1-3-25-5-6-26-4-2-16-10(14(23)24)8-12(19)20;/h9-10,15-16H,1-8H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24);1H |
| InChIKey | DTIUZMHIHANKSQ-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 191.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.81 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|