C10H21NO7Si — CID 87235100
(2S)-2-(3-trimethoxysilylpropylamino)butanedioic acid (PubChem CID 87235100) has the molecular formula C10H21NO7Si and a molecular weight of 295.36 g/mol. Its IUPAC name is (2S)-2-(3-trimethoxysilylpropylamino)butanedioic acid.
| Compound Name | (2S)-2-(3-trimethoxysilylpropylamino)butanedioic acid |
|---|---|
| PubChem CID | 87235100 |
| Molecular Formula | C10H21NO7Si |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (2S)-2-(3-trimethoxysilylpropylamino)butanedioic acid |
| SMILES | CO[Si](CCCN[C@@H](CC(=O)O)C(=O)O)(OC)OC |
| InChI | InChI=1S/C10H21NO7Si/c1-16-19(17-2,18-3)6-4-5-11-8(10(14)15)7-9(12)13/h8,11H,4-7H2,1-3H3,(H,12,13)(H,14,15)/t8-/m0/s1 |
| InChIKey | DBUOTWAGHJHKQL-QMMMGPOBSA-N |
| XLogP | -0.23 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|