C12H20N2O10 — CID 19853498
2-[2-[2-[2-(dicarboxymethylamino)ethoxy]ethoxy]ethylamino]propanedioic acid (PubChem CID 19853498) has the molecular formula C12H20N2O10 and a molecular weight of 352.30 g/mol. Its IUPAC name is 2-[2-[2-[2-(dicarboxymethylamino)ethoxy]ethoxy]ethylamino]propanedioic acid.
| Compound Name | 2-[2-[2-[2-(dicarboxymethylamino)ethoxy]ethoxy]ethylamino]propanedioic acid |
|---|---|
| PubChem CID | 19853498 |
| Molecular Formula | C12H20N2O10 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-[2-[2-[2-(dicarboxymethylamino)ethoxy]ethoxy]ethylamino]propanedioic acid |
| SMILES | O=C(O)C(NCCOCCOCCNC(C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H20N2O10/c15-9(16)7(10(17)18)13-1-3-23-5-6-24-4-2-14-8(11(19)20)12(21)22/h7-8,13-14H,1-6H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | IQVSCPOMGODOKD-UHFFFAOYSA-N |
| XLogP | -2.73 |
| TPSA | 191.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|