C8H12N2O8 — CID 89457539
2-[2-(diformyloxymethylamino)ethylamino]propanedioic acid (PubChem CID 89457539) has the molecular formula C8H12N2O8 and a molecular weight of 264.19 g/mol. Its IUPAC name is 2-[2-(diformyloxymethylamino)ethylamino]propanedioic acid.
| Compound Name | 2-[2-(diformyloxymethylamino)ethylamino]propanedioic acid |
|---|---|
| PubChem CID | 89457539 |
| Molecular Formula | C8H12N2O8 |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-[2-(diformyloxymethylamino)ethylamino]propanedioic acid |
| SMILES | O=COC(NCCNC(C(=O)O)C(=O)O)OC=O |
| InChI | InChI=1S/C8H12N2O8/c11-3-17-8(18-4-12)10-2-1-9-5(6(13)14)7(15)16/h3-5,8-10H,1-2H2,(H,13,14)(H,15,16) |
| InChIKey | ZQRNRHJEBRZGJQ-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|