C5H11N3O6 — CID 158445121
2-(carboxymethylamino)propanedioic acid;hydrazine (PubChem CID 158445121) has the molecular formula C5H11N3O6 and a molecular weight of 209.16 g/mol. Its IUPAC name is 2-(carboxymethylamino)propanedioic acid;hydrazine.
| Compound Name | 2-(carboxymethylamino)propanedioic acid;hydrazine |
|---|---|
| PubChem CID | 158445121 |
| Molecular Formula | C5H11N3O6 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-(carboxymethylamino)propanedioic acid;hydrazine |
| SMILES | NN.O=C(O)CNC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C5H7NO6.H4N2/c7-2(8)1-6-3(4(9)10)5(11)12;1-2/h3,6H,1H2,(H,7,8)(H,9,10)(H,11,12);1-2H2 |
| InChIKey | HDHJULWYDMCDBU-UHFFFAOYSA-N |
| XLogP | -2.98 |
| TPSA | 175.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|