C8H16N2O4 — CID 11680034
6-amino-2-(carboxymethylamino)hexanoic acid (PubChem CID 11680034) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is 6-amino-2-(carboxymethylamino)hexanoic acid.
| Compound Name | 6-amino-2-(carboxymethylamino)hexanoic acid |
|---|---|
| PubChem CID | 11680034 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 6-amino-2-(carboxymethylamino)hexanoic acid |
| SMILES | NCCCCC(NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H16N2O4/c9-4-2-1-3-6(8(13)14)10-5-7(11)12/h6,10H,1-5,9H2,(H,11,12)(H,13,14) |
| InChIKey | OQVOZFPJUCUPLW-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|