C9H20N2O4 — CID 87855201
(2S)-6-amino-2-(3,3-dihydroxypropylamino)hexanoic acid (PubChem CID 87855201) has the molecular formula C9H20N2O4 and a molecular weight of 220.27 g/mol. Its IUPAC name is (2S)-6-amino-2-(3,3-dihydroxypropylamino)hexanoic acid.
| Compound Name | (2S)-6-amino-2-(3,3-dihydroxypropylamino)hexanoic acid |
|---|---|
| PubChem CID | 87855201 |
| Molecular Formula | C9H20N2O4 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | (2S)-6-amino-2-(3,3-dihydroxypropylamino)hexanoic acid |
| SMILES | NCCCC[C@H](NCCC(O)O)C(=O)O |
| InChI | InChI=1S/C9H20N2O4/c10-5-2-1-3-7(9(14)15)11-6-4-8(12)13/h7-8,11-13H,1-6,10H2,(H,14,15)/t7-/m0/s1 |
| InChIKey | GFIQDQDPPZEFCT-ZETCQYMHSA-N |
| XLogP | -1.14 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|