About 5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride
5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride (PubChem CID 174056033) has the molecular formula C11H28Cl3N3O2
and a molecular weight of 340.72 g/mol. Its IUPAC name is 5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride.
Molecular Properties
| Compound Name | 5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride |
| PubChem CID | 174056033 |
| Molecular Formula | C11H28Cl3N3O2 |
| Molecular Weight | 340.72 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride |
| SMILES | Cl.Cl.Cl.NCCCCCCNC(CCCN)C(=O)O |
| InChI | InChI=1S/C11H25N3O2.3ClH/c12-7-3-1-2-4-9-14-10(11(15)16)6-5-8-13;;;/h10,14H,1-9,12-13H2,(H,15,16);3*1H |
| InChIKey | PTDHIOJUTFDWID-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.72 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride?
The IUPAC name of 5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride (CID 174056033) is 5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride.
What is the SMILES notation for 5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride?
The canonical SMILES for 5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride is Cl.Cl.Cl.NCCCCCCNC(CCCN)C(=O)O.
What is the InChIKey of 5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride?
The InChIKey is PTDHIOJUTFDWID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3O2.3ClH/c12-7-3-1-2-4-9-14-10(11(15)16)6-5-8-13;;;/h10,14H,1-9,12-13H2,(H,15,16);3*1H.
What are the key properties of 5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride?
5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride has a molecular weight of 340.72 g/mol, XLogP of 1.55, 11 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride is sourced from PubChem (CID 174056033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).