C17H36N2O5 — CID 138727258
2-methyl-N-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 138727258) has the molecular formula C17H36N2O5 and a molecular weight of 348.48 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 138727258 |
| Molecular Formula | C17H36N2O5 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | 2-methyl-N-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CC(C)NCCOCCOCCOCCOCCNC(=O)C(C)C |
| InChI | InChI=1S/C17H36N2O5/c1-15(2)17(20)19-6-8-22-10-12-24-14-13-23-11-9-21-7-5-18-16(3)4/h15-16,18H,5-14H2,1-4H3,(H,19,20) |
| InChIKey | XXCXONMBMKQCSA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|