C9H19NO3 — CID 172574123
2-[2-(propan-2-ylamino)ethoxy]ethyl acetate (PubChem CID 172574123) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is 2-[2-(propan-2-ylamino)ethoxy]ethyl acetate.
| Compound Name | 2-[2-(propan-2-ylamino)ethoxy]ethyl acetate |
|---|---|
| PubChem CID | 172574123 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 2-[2-(propan-2-ylamino)ethoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCCNC(C)C |
| InChI | InChI=1S/C9H19NO3/c1-8(2)10-4-5-12-6-7-13-9(3)11/h8,10H,4-7H2,1-3H3 |
| InChIKey | ZPXUDSXZNHVHAF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|