C10H16N2O7 — CID 144764828
2-[2-[(1-carboxy-3-oxopropan-2-yl)amino]ethylamino]butanedioic acid (PubChem CID 144764828) has the molecular formula C10H16N2O7 and a molecular weight of 276.25 g/mol. Its IUPAC name is 2-[2-[(1-carboxy-3-oxopropan-2-yl)amino]ethylamino]butanedioic acid.
| Compound Name | 2-[2-[(1-carboxy-3-oxopropan-2-yl)amino]ethylamino]butanedioic acid |
|---|---|
| PubChem CID | 144764828 |
| Molecular Formula | C10H16N2O7 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-[2-[(1-carboxy-3-oxopropan-2-yl)amino]ethylamino]butanedioic acid |
| SMILES | O=CC(CC(=O)O)NCCNC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N2O7/c13-5-6(3-8(14)15)11-1-2-12-7(10(18)19)4-9(16)17/h5-7,11-12H,1-4H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | AALZHNOSZZJFLD-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|