C12H23N3O6 — CID 59510977
2-[2-[2-(1-carboxypropan-2-ylamino)ethylamino]ethylamino]butanedioic acid (PubChem CID 59510977) has the molecular formula C12H23N3O6 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-[2-[2-(1-carboxypropan-2-ylamino)ethylamino]ethylamino]butanedioic acid.
| Compound Name | 2-[2-[2-(1-carboxypropan-2-ylamino)ethylamino]ethylamino]butanedioic acid |
|---|---|
| PubChem CID | 59510977 |
| Molecular Formula | C12H23N3O6 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-[2-[2-(1-carboxypropan-2-ylamino)ethylamino]ethylamino]butanedioic acid |
| SMILES | CC(CC(=O)O)NCCNCCNC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H23N3O6/c1-8(6-10(16)17)14-4-2-13-3-5-15-9(12(20)21)7-11(18)19/h8-9,13-15H,2-7H2,1H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | KFMGUDXPHHXTQN-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|