C14H28N4O5 — CID 21468396
2-[2-[2-(carboxymethylamino)ethylamino]ethylamino]-4-(diethylamino)-4-oxobutanoic acid (PubChem CID 21468396) has the molecular formula C14H28N4O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-[2-[2-(carboxymethylamino)ethylamino]ethylamino]-4-(diethylamino)-4-oxobutanoic acid.
| Compound Name | 2-[2-[2-(carboxymethylamino)ethylamino]ethylamino]-4-(diethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 21468396 |
| Molecular Formula | C14H28N4O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2-[2-[2-(carboxymethylamino)ethylamino]ethylamino]-4-(diethylamino)-4-oxobutanoic acid |
| SMILES | CCN(CC)C(=O)CC(NCCNCCNCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H28N4O5/c1-3-18(4-2)12(19)9-11(14(22)23)17-8-7-15-5-6-16-10-13(20)21/h11,15-17H,3-10H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | NKQVOOVRCKLZLV-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|