C11H21N3O4 — CID 113363699
2-[[2-(diethylamino)-2-oxoethyl]carbamoylamino]butanoic acid (PubChem CID 113363699) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-[[2-(diethylamino)-2-oxoethyl]carbamoylamino]butanoic acid.
| Compound Name | 2-[[2-(diethylamino)-2-oxoethyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 113363699 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 2-[[2-(diethylamino)-2-oxoethyl]carbamoylamino]butanoic acid |
| SMILES | CCC(NC(=O)NCC(=O)N(CC)CC)C(=O)O |
| InChI | InChI=1S/C11H21N3O4/c1-4-8(10(16)17)13-11(18)12-7-9(15)14(5-2)6-3/h8H,4-7H2,1-3H3,(H,16,17)(H2,12,13,18) |
| InChIKey | YCNFSMWCHUAKAP-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |