C7H15N3O3 — CID 83018515
2-(dimethylaminocarbamoylamino)butanoic acid (PubChem CID 83018515) has the molecular formula C7H15N3O3 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-(dimethylaminocarbamoylamino)butanoic acid.
| Compound Name | 2-(dimethylaminocarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 83018515 |
| Molecular Formula | C7H15N3O3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | 2-(dimethylaminocarbamoylamino)butanoic acid |
| SMILES | CCC(NC(=O)NN(C)C)C(=O)O |
| InChI | InChI=1S/C7H15N3O3/c1-4-5(6(11)12)8-7(13)9-10(2)3/h5H,4H2,1-3H3,(H,11,12)(H2,8,9,13) |
| InChIKey | CLFYNMCJUTZGEF-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|