C15H23NO4 — CID 57107214
(2R)-2-[[2-hydroxy-3-(4-hydroxyphenyl)propyl]amino]-4-methylpentanoic acid (PubChem CID 57107214) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (2R)-2-[[2-hydroxy-3-(4-hydroxyphenyl)propyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[2-hydroxy-3-(4-hydroxyphenyl)propyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 57107214 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (2R)-2-[[2-hydroxy-3-(4-hydroxyphenyl)propyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NCC(O)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C15H23NO4/c1-10(2)7-14(15(19)20)16-9-13(18)8-11-3-5-12(17)6-4-11/h3-6,10,13-14,16-18H,7-9H2,1-2H3,(H,19,20)/t13?,14-/m1/s1 |
| InChIKey | WRWNUXWMTIBARW-ARLHGKGLSA-N |
| XLogP | 1.38 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |