C16H26N2O3 — CID 57064467
(2S)-2-[(3-amino-2-hydroxy-4-phenylbutyl)amino]-4-methylpentanoic acid (PubChem CID 57064467) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is (2S)-2-[(3-amino-2-hydroxy-4-phenylbutyl)amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(3-amino-2-hydroxy-4-phenylbutyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 57064467 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (2S)-2-[(3-amino-2-hydroxy-4-phenylbutyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NCC(O)C(N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H26N2O3/c1-11(2)8-14(16(20)21)18-10-15(19)13(17)9-12-6-4-3-5-7-12/h3-7,11,13-15,18-19H,8-10,17H2,1-2H3,(H,20,21)/t13?,14-,15?/m0/s1 |
| InChIKey | NKAOIAGCQMMQLM-SLTAFYQDSA-N |
| XLogP | 1.01 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |