C16H27N3OS — CID 14186622
(2S)-2-[[(3S)-3-amino-4-phenyl-2-sulfanylbutyl]amino]-4-methylpentanamide (PubChem CID 14186622) has the molecular formula C16H27N3OS and a molecular weight of 309.48 g/mol. Its IUPAC name is (2S)-2-[[(3S)-3-amino-4-phenyl-2-sulfanylbutyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(3S)-3-amino-4-phenyl-2-sulfanylbutyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 14186622 |
| Molecular Formula | C16H27N3OS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (2S)-2-[[(3S)-3-amino-4-phenyl-2-sulfanylbutyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NCC(S)[C@@H](N)Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C16H27N3OS/c1-11(2)8-14(16(18)20)19-10-15(21)13(17)9-12-6-4-3-5-7-12/h3-7,11,13-15,19,21H,8-10,17H2,1-2H3,(H2,18,20)/t13-,14-,15?/m0/s1 |
| InChIKey | BUANGZVJUPGXHJ-ZYOSVBKOSA-N |
| XLogP | 1.34 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|