C16H26N2O2S — CID 14186611
(2S)-2-[[(2R,3S)-3-amino-4-phenyl-2-sulfanylbutyl]amino]-4-methylpentanoic acid (PubChem CID 14186611) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is (2S)-2-[[(2R,3S)-3-amino-4-phenyl-2-sulfanylbutyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2R,3S)-3-amino-4-phenyl-2-sulfanylbutyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 14186611 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (2S)-2-[[(2R,3S)-3-amino-4-phenyl-2-sulfanylbutyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC[C@@H](S)[C@@H](N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H26N2O2S/c1-11(2)8-14(16(19)20)18-10-15(21)13(17)9-12-6-4-3-5-7-12/h3-7,11,13-15,18,21H,8-10,17H2,1-2H3,(H,19,20)/t13-,14-,15+/m0/s1 |
| InChIKey | VVXNEXXFHWJKLS-SOUVJXGZSA-N |
| XLogP | 1.94 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|