C22H32N2O5 — CID 21397706
1-(2-methoxy-4-phenylmethoxyphenoxy)-3-(propan-2-ylamino)propan-2-ol;N-methylformamide (PubChem CID 21397706) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is 1-(2-methoxy-4-phenylmethoxyphenoxy)-3-(propan-2-ylamino)propan-2-ol;N-methylformamide.
| Compound Name | 1-(2-methoxy-4-phenylmethoxyphenoxy)-3-(propan-2-ylamino)propan-2-ol;N-methylformamide |
|---|---|
| PubChem CID | 21397706 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 1-(2-methoxy-4-phenylmethoxyphenoxy)-3-(propan-2-ylamino)propan-2-ol;N-methylformamide |
| SMILES | CNC=O.COc1cc(OCc2ccccc2)ccc1OCC(O)CNC(C)C |
| InChI | InChI=1S/C20H27NO4.C2H5NO/c1-15(2)21-12-17(22)14-25-19-10-9-18(11-20(19)23-3)24-13-16-7-5-4-6-8-16;1-3-2-4/h4-11,15,17,21-22H,12-14H2,1-3H3;2H,1H3,(H,3,4) |
| InChIKey | SCRKKEAOLDHIGI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|