C15H26N2O5 — CID 21397689
4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-methoxyphenol;N-methylformamide (PubChem CID 21397689) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-methoxyphenol;N-methylformamide.
| Compound Name | 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-methoxyphenol;N-methylformamide |
|---|---|
| PubChem CID | 21397689 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]-3-methoxyphenol;N-methylformamide |
| SMILES | CNC=O.COc1cc(O)ccc1OCC(O)CNC(C)C |
| InChI | InChI=1S/C13H21NO4.C2H5NO/c1-9(2)14-7-11(16)8-18-12-5-4-10(15)6-13(12)17-3;1-3-2-4/h4-6,9,11,14-16H,7-8H2,1-3H3;2H,1H3,(H,3,4) |
| InChIKey | UEPNPRBFBFIGTC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|