C13H22N2O3 — CID 154089660
1-(2-amino-5-methoxyphenoxy)-3-(propan-2-ylamino)propan-2-ol (PubChem CID 154089660) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(2-amino-5-methoxyphenoxy)-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-(2-amino-5-methoxyphenoxy)-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 154089660 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-(2-amino-5-methoxyphenoxy)-3-(propan-2-ylamino)propan-2-ol |
| SMILES | COc1ccc(N)c(OCC(O)CNC(C)C)c1 |
| InChI | InChI=1S/C13H22N2O3/c1-9(2)15-7-10(16)8-18-13-6-11(17-3)4-5-12(13)14/h4-6,9-10,15-16H,7-8,14H2,1-3H3 |
| InChIKey | SCLDWGHNIIKRGZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|