C13H22N2O2 — CID 62273853
1-(3-aminopropylamino)-3-(2-methylphenoxy)propan-2-ol (PubChem CID 62273853) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-(3-aminopropylamino)-3-(2-methylphenoxy)propan-2-ol.
| Compound Name | 1-(3-aminopropylamino)-3-(2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 62273853 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-(3-aminopropylamino)-3-(2-methylphenoxy)propan-2-ol |
| SMILES | Cc1ccccc1OCC(O)CNCCCN |
| InChI | InChI=1S/C13H22N2O2/c1-11-5-2-3-6-13(11)17-10-12(16)9-15-8-4-7-14/h2-3,5-6,12,15-16H,4,7-10,14H2,1H3 |
| InChIKey | VTZKVZQKAMMMHQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|