C18H31NO2 — CID 12548704
1-(2-methylphenoxy)-3-(octylamino)propan-2-ol (PubChem CID 12548704) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-(2-methylphenoxy)-3-(octylamino)propan-2-ol.
| Compound Name | 1-(2-methylphenoxy)-3-(octylamino)propan-2-ol |
|---|---|
| PubChem CID | 12548704 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 1-(2-methylphenoxy)-3-(octylamino)propan-2-ol |
| SMILES | CCCCCCCCNCC(O)COc1ccccc1C |
| InChI | InChI=1S/C18H31NO2/c1-3-4-5-6-7-10-13-19-14-17(20)15-21-18-12-9-8-11-16(18)2/h8-9,11-12,17,19-20H,3-7,10,13-15H2,1-2H3 |
| InChIKey | MWGVLJBIBICBOE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|