C16H26N4O3 — CID 110181612
2-[3-[[2-hydroxy-3-(2-prop-2-enoxyphenoxy)propyl]amino]propyl]guanidine (PubChem CID 110181612) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-[3-[[2-hydroxy-3-(2-prop-2-enoxyphenoxy)propyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[2-hydroxy-3-(2-prop-2-enoxyphenoxy)propyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 110181612 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 2-[3-[[2-hydroxy-3-(2-prop-2-enoxyphenoxy)propyl]amino]propyl]guanidine |
| SMILES | C=CCOc1ccccc1OCC(O)CNCCCN=C(N)N |
| InChI | InChI=1S/C16H26N4O3/c1-2-10-22-14-6-3-4-7-15(14)23-12-13(21)11-19-8-5-9-20-16(17)18/h2-4,6-7,13,19,21H,1,5,8-12H2,(H4,17,18,20) |
| InChIKey | BXTKLRWELBRENO-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|