C13H19FN2O3 — CID 54937821
4-[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]butanamide (PubChem CID 54937821) has the molecular formula C13H19FN2O3 and a molecular weight of 270.30 g/mol. Its IUPAC name is 4-[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]butanamide.
| Compound Name | 4-[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]butanamide |
|---|---|
| PubChem CID | 54937821 |
| Molecular Formula | C13H19FN2O3 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 4-[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]butanamide |
| SMILES | NC(=O)CCCNCC(O)COc1ccccc1F |
| InChI | InChI=1S/C13H19FN2O3/c14-11-4-1-2-5-12(11)19-9-10(17)8-16-7-3-6-13(15)18/h1-2,4-5,10,16-17H,3,6-9H2,(H2,15,18) |
| InChIKey | OISZSWRTJLIAPC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|