C15H20FN3O2 — CID 115579730
1-(2-fluorophenoxy)-3-(3-pyrazol-1-ylpropylamino)propan-2-ol (PubChem CID 115579730) has the molecular formula C15H20FN3O2 and a molecular weight of 293.34 g/mol. Its IUPAC name is 1-(2-fluorophenoxy)-3-(3-pyrazol-1-ylpropylamino)propan-2-ol.
| Compound Name | 1-(2-fluorophenoxy)-3-(3-pyrazol-1-ylpropylamino)propan-2-ol |
|---|---|
| PubChem CID | 115579730 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 1-(2-fluorophenoxy)-3-(3-pyrazol-1-ylpropylamino)propan-2-ol |
| SMILES | OC(CNCCCn1cccn1)COc1ccccc1F |
| InChI | InChI=1S/C15H20FN3O2/c16-14-5-1-2-6-15(14)21-12-13(20)11-17-7-3-9-19-10-4-8-18-19/h1-2,4-6,8,10,13,17,20H,3,7,9,11-12H2 |
| InChIKey | YDIXGHWJANEUJM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|