C14H18ClN3O2 — CID 61462609
1-(2-chlorophenoxy)-3-(2-pyrazol-1-ylethylamino)propan-2-ol (PubChem CID 61462609) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 1-(2-chlorophenoxy)-3-(2-pyrazol-1-ylethylamino)propan-2-ol.
| Compound Name | 1-(2-chlorophenoxy)-3-(2-pyrazol-1-ylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 61462609 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-(2-chlorophenoxy)-3-(2-pyrazol-1-ylethylamino)propan-2-ol |
| SMILES | OC(CNCCn1cccn1)COc1ccccc1Cl |
| InChI | InChI=1S/C14H18ClN3O2/c15-13-4-1-2-5-14(13)20-11-12(19)10-16-7-9-18-8-3-6-17-18/h1-6,8,12,16,19H,7,9-11H2 |
| InChIKey | SHRSAVNTBPCRJO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|