C9H17N3O — CID 106932499
(2R)-1-(3-pyrazol-1-ylpropylamino)propan-2-ol (PubChem CID 106932499) has the molecular formula C9H17N3O and a molecular weight of 183.26 g/mol. Its IUPAC name is (2R)-1-(3-pyrazol-1-ylpropylamino)propan-2-ol.
| Compound Name | (2R)-1-(3-pyrazol-1-ylpropylamino)propan-2-ol |
|---|---|
| PubChem CID | 106932499 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (2R)-1-(3-pyrazol-1-ylpropylamino)propan-2-ol |
| SMILES | C[C@@H](O)CNCCCn1cccn1 |
| InChI | InChI=1S/C9H17N3O/c1-9(13)8-10-4-2-6-12-7-3-5-11-12/h3,5,7,9-10,13H,2,4,6,8H2,1H3/t9-/m1/s1 |
| InChIKey | YTOILNLHJMYIHC-SECBINFHSA-N |
| XLogP | 0.24 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|