C8H16N4O — CID 106932503
(2R)-1-[3-(triazol-1-yl)propylamino]propan-2-ol (PubChem CID 106932503) has the molecular formula C8H16N4O and a molecular weight of 184.24 g/mol. Its IUPAC name is (2R)-1-[3-(triazol-1-yl)propylamino]propan-2-ol.
| Compound Name | (2R)-1-[3-(triazol-1-yl)propylamino]propan-2-ol |
|---|---|
| PubChem CID | 106932503 |
| Molecular Formula | C8H16N4O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (2R)-1-[3-(triazol-1-yl)propylamino]propan-2-ol |
| SMILES | C[C@@H](O)CNCCCn1ccnn1 |
| InChI | InChI=1S/C8H16N4O/c1-8(13)7-9-3-2-5-12-6-4-10-11-12/h4,6,8-9,13H,2-3,5,7H2,1H3/t8-/m1/s1 |
| InChIKey | CYRWNLUTUGJQGK-MRVPVSSYSA-N |
| XLogP | -0.36 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|